C25H25F6N5O2 — CID 170259294
8-methoxy-2-(2,2,2-trifluoroethyl)-6-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyridin-3-yl]-3,4-dihydroisoquinolin-1-one (PubChem CID 170259294) has the molecular formula C25H25F6N5O2 and a molecular weight of 541.50 g/mol. Its IUPAC name is 8-methoxy-2-(2,2,2-trifluoroethyl)-6-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyridin-3-yl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 8-methoxy-2-(2,2,2-trifluoroethyl)-6-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyridin-3-yl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 170259294 |
| Molecular Formula | C25H25F6N5O2 |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 8-methoxy-2-(2,2,2-trifluoroethyl)-6-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyridin-3-yl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc(-c2cnn3cc(N4CCN(CC(F)(F)F)CC4)ccc23)cc2c1C(=O)N(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C25H25F6N5O2/c1-38-21-11-17(10-16-4-5-35(15-25(29,30)31)23(37)22(16)21)19-12-32-36-13-18(2-3-20(19)36)34-8-6-33(7-9-34)14-24(26,27)28/h2-3,10-13H,4-9,14-15H2,1H3 |
| InChIKey | DZJHCXPONRCUJY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |