C18H32FN — CID 170260209
(5Z,7E)-N-ethyl-8-fluoro-2,4-dimethyl-5-(2-methylbutyl)nona-5,7-dien-3-imine (PubChem CID 170260209) has the molecular formula C18H32FN and a molecular weight of 281.46 g/mol. Its IUPAC name is (5Z,7E)-N-ethyl-8-fluoro-2,4-dimethyl-5-(2-methylbutyl)nona-5,7-dien-3-imine.
| Compound Name | (5Z,7E)-N-ethyl-8-fluoro-2,4-dimethyl-5-(2-methylbutyl)nona-5,7-dien-3-imine |
|---|---|
| PubChem CID | 170260209 |
| Molecular Formula | C18H32FN |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | (5Z,7E)-N-ethyl-8-fluoro-2,4-dimethyl-5-(2-methylbutyl)nona-5,7-dien-3-imine |
| SMILES | CC/N=C(\C(C)C)C(C)/C(=C\C=C(/C)F)CC(C)CC |
| InChI | InChI=1S/C18H32FN/c1-8-14(5)12-17(11-10-15(6)19)16(7)18(13(3)4)20-9-2/h10-11,13-14,16H,8-9,12H2,1-7H3/b15-10+,17-11-,20-18+ |
| InChIKey | ZLKSNBDGRXVJIA-PNDLAQAPSA-N |
| XLogP | 5.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|