C10H14F3NO2 — CID 170260337
(2Z)-2-ethyl-3-methoxy-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide (PubChem CID 170260337) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is (2Z)-2-ethyl-3-methoxy-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-2-ethyl-3-methoxy-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 170260337 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2Z)-2-ethyl-3-methoxy-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide |
| SMILES | C=C/C(OC)=C(\CC)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2/c1-4-7(8(5-2)16-3)9(15)14-6-10(11,12)13/h5H,2,4,6H2,1,3H3,(H,14,15)/b8-7- |
| InChIKey | JTEFVVBJIVRKIM-FPLPWBNLSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|