C10H18F3N — CID 170260356
(E)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)hex-3-en-1-amine (PubChem CID 170260356) has the molecular formula C10H18F3N and a molecular weight of 209.25 g/mol. Its IUPAC name is (E)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)hex-3-en-1-amine.
| Compound Name | (E)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)hex-3-en-1-amine |
|---|---|
| PubChem CID | 170260356 |
| Molecular Formula | C10H18F3N |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (E)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)hex-3-en-1-amine |
| SMILES | CC/C=C(\C)CCN(C)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3N/c1-4-5-9(2)6-7-14(3)8-10(11,12)13/h5H,4,6-8H2,1-3H3/b9-5+ |
| InChIKey | IZJGFJFHWSITHG-WEVVVXLNSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|