C24H32FN3O3 — CID 170261034
N-[1-(4-fluoroanilino)-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide (PubChem CID 170261034) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[1-(4-fluoroanilino)-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide.
| Compound Name | N-[1-(4-fluoroanilino)-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 170261034 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[1-(4-fluoroanilino)-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide |
| SMILES | CCCCC(NC(=O)c1[nH]c2c(c1C)C(O)CC(C)(C)C2)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O3/c1-5-6-7-17(22(30)26-16-10-8-15(25)9-11-16)28-23(31)21-14(2)20-18(27-21)12-24(3,4)13-19(20)29/h8-11,17,19,27,29H,5-7,12-13H2,1-4H3,(H,26,30)(H,28,31) |
| InChIKey | MEGCHVCHTRXWCJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |