C28H17N5O3 — CID 17026122
6-(4-nitrophenyl)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene (PubChem CID 17026122) has the molecular formula C28H17N5O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene.
| Compound Name | 6-(4-nitrophenyl)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 17026122 |
| Molecular Formula | C28H17N5O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 6-(4-nitrophenyl)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3c4c(ncn3n2)Oc2c(ccc3ccccc23)C4c2ccccc2)cc1 |
| InChI | InChI=1S/C28H17N5O3/c34-33(35)20-13-10-19(11-14-20)26-30-27-24-23(18-7-2-1-3-8-18)22-15-12-17-6-4-5-9-21(17)25(22)36-28(24)29-16-32(27)31-26/h1-16,23H |
| InChIKey | DINKWOFKNTZDBF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|