C18H19NO8 — CID 170261454
[(2S,3R,4S)-3-acetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyloxan-4-yl] acetate (PubChem CID 170261454) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is [(2S,3R,4S)-3-acetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyloxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S)-3-acetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 170261454 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [(2S,3R,4S)-3-acetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)OC(ON2C(=O)c3ccccc3C2=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H19NO8/c1-9-16(26-11(3)21)14(25-10(2)20)8-15(24-9)27-19-17(22)12-6-4-5-7-13(12)18(19)23/h4-7,9,14-16H,8H2,1-3H3/t9-,14-,15?,16+/m0/s1 |
| InChIKey | HJQCRVKXRYDQCR-KWWYPOAGSA-N |
| XLogP | 1.21 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|