C24H31IO7 — CID 170261576
8-(4-hydroxy-1-iodobutan-2-yl)oxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 170261576) has the molecular formula C24H31IO7 and a molecular weight of 558.41 g/mol. Its IUPAC name is 8-(4-hydroxy-1-iodobutan-2-yl)oxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | 8-(4-hydroxy-1-iodobutan-2-yl)oxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 170261576 |
| Molecular Formula | C24H31IO7 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 8-(4-hydroxy-1-iodobutan-2-yl)oxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CC(C)C12OC1C1OC13C1(C)CCC4=C(COC4=O)C1CC1OC13C2OC(CI)CCO |
| InChI | InChI=1S/C24H31IO7/c1-11(2)22-17(31-22)18-24(32-18)21(3)6-4-13-14(10-28-19(13)27)15(21)8-16-23(24,30-16)20(22)29-12(9-25)5-7-26/h11-12,15-18,20,26H,4-10H2,1-3H3 |
| InChIKey | QVLZRFLYNKQMIF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|