C12H10F2O3 — CID 170261811
(3E,5E)-6-(2,6-difluorophenyl)-1,1-dihydroxyhexa-3,5-dien-2-one (PubChem CID 170261811) has the molecular formula C12H10F2O3 and a molecular weight of 240.21 g/mol. Its IUPAC name is (3E,5E)-6-(2,6-difluorophenyl)-1,1-dihydroxyhexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-(2,6-difluorophenyl)-1,1-dihydroxyhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 170261811 |
| Molecular Formula | C12H10F2O3 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (3E,5E)-6-(2,6-difluorophenyl)-1,1-dihydroxyhexa-3,5-dien-2-one |
| SMILES | O=C(/C=C/C=C/c1c(F)cccc1F)C(O)O |
| InChI | InChI=1S/C12H10F2O3/c13-9-5-3-6-10(14)8(9)4-1-2-7-11(15)12(16)17/h1-7,12,16-17H/b4-1+,7-2+ |
| InChIKey | RQCKDXMNAIQTFJ-BQJQTIKASA-N |
| XLogP | 1.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|