C24H23F3N4O5 — CID 170262433
N-[(3aS,4S,5S,7S,7aR)-4,7-dimethyl-2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-3-acetyl-1H-pyrazole-5-carboxamide (PubChem CID 170262433) has the molecular formula C24H23F3N4O5 and a molecular weight of 504.47 g/mol. Its IUPAC name is N-[(3aS,4S,5S,7S,7aR)-4,7-dimethyl-2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-3-acetyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3aS,4S,5S,7S,7aR)-4,7-dimethyl-2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-3-acetyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 170262433 |
| Molecular Formula | C24H23F3N4O5 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[(3aS,4S,5S,7S,7aR)-4,7-dimethyl-2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-3-acetyl-1H-pyrazole-5-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)N[C@H]2C[C@]3(C)O[C@@]2(C)[C@H]2C(=O)N(c4ccc(C)c(C(F)(F)F)c4)C(=O)[C@H]23)[nH]n1 |
| InChI | InChI=1S/C24H23F3N4O5/c1-10-5-6-12(7-13(10)24(25,26)27)31-20(34)17-18(21(31)35)23(4)16(9-22(17,3)36-23)28-19(33)15-8-14(11(2)32)29-30-15/h5-8,16-18H,9H2,1-4H3,(H,28,33)(H,29,30)/t16-,17-,18+,22-,23+/m0/s1 |
| InChIKey | SCTWUXUMLDXUTN-JNPMMSBMSA-N |
| XLogP | 2.80 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|