C29H40N4O2 — CID 170262498
3-methoxy-5-(3-methylphenyl)-2-[(1Z)-1-[[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyldiazenyl]buta-1,3-dienyl]phenol (PubChem CID 170262498) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 3-methoxy-5-(3-methylphenyl)-2-[(1Z)-1-[[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyldiazenyl]buta-1,3-dienyl]phenol.
| Compound Name | 3-methoxy-5-(3-methylphenyl)-2-[(1Z)-1-[[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyldiazenyl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 170262498 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 3-methoxy-5-(3-methylphenyl)-2-[(1Z)-1-[[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyldiazenyl]buta-1,3-dienyl]phenol |
| SMILES | C=C/C=C(\N=N\CN(C)C1CC(C)(C)NC(C)(C)C1)c1c(O)cc(-c2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C29H40N4O2/c1-9-11-24(31-30-19-33(7)23-17-28(3,4)32-29(5,6)18-23)27-25(34)15-22(16-26(27)35-8)21-13-10-12-20(2)14-21/h9-16,23,32,34H,1,17-19H2,2-8H3/b24-11-,31-30+ |
| InChIKey | YXLAMBBGABEDAA-UXWWLMLOSA-N |
| XLogP | 6.55 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|