About N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide
N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide (PubChem CID 170263457) has the molecular formula C10H21F3N2O2S
and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide |
| PubChem CID | 170263457 |
| Molecular Formula | C10H21F3N2O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide |
| SMILES | CC(C)NC(CCC(C)NS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C10H21F3N2O2S/c1-7(2)14-9(10(11,12)13)6-5-8(3)15-18(4,16)17/h7-9,14-15H,5-6H2,1-4H3 |
| InChIKey | BUKKAJGHJIRFDE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide?
The IUPAC name of N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide (CID 170263457) is N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide?
The canonical SMILES for N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide is CC(C)NC(CCC(C)NS(C)(=O)=O)C(F)(F)F.
What is the InChIKey of N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide?
The InChIKey is BUKKAJGHJIRFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3N2O2S/c1-7(2)14-9(10(11,12)13)6-5-8(3)15-18(4,16)17/h7-9,14-15H,5-6H2,1-4H3.
What are the key properties of N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide?
N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide has a molecular weight of 290.35 g/mol, XLogP of 1.63, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6,6,6-trifluoro-5-(propan-2-ylamino)hexan-2-yl]methanesulfonamide is sourced from PubChem (CID 170263457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).