C12H18F9N3O3S3 — CID 170264444
1,3,5-tris[3-(trifluoro-λ4-sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 170264444) has the molecular formula C12H18F9N3O3S3 and a molecular weight of 519.48 g/mol. Its IUPAC name is 1,3,5-tris[3-(trifluoro-λ4-sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[3-(trifluoro-λ4-sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 170264444 |
| Molecular Formula | C12H18F9N3O3S3 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 1,3,5-tris[3-(trifluoro-λ4-sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCCS(F)(F)F)c(=O)n(CCCS(F)(F)F)c(=O)n1CCCS(F)(F)F |
| InChI | InChI=1S/C12H18F9N3O3S3/c13-28(14,15)7-1-4-22-10(25)23(5-2-8-29(16,17)18)12(27)24(11(22)26)6-3-9-30(19,20)21/h1-9H2 |
| InChIKey | BOBFLIZMPJRQKK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |