C13H27NOS — CID 170264502
2,2-dimethylbut-3-enyl-(2,2-dimethylbutyl)-methylimino-oxo-λ6-sulfane (PubChem CID 170264502) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is 2,2-dimethylbut-3-enyl-(2,2-dimethylbutyl)-methylimino-oxo-λ6-sulfane.
| Compound Name | 2,2-dimethylbut-3-enyl-(2,2-dimethylbutyl)-methylimino-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 170264502 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2,2-dimethylbut-3-enyl-(2,2-dimethylbutyl)-methylimino-oxo-λ6-sulfane |
| SMILES | C=CC(C)(C)CS(=O)(CC(C)(C)CC)=NC |
| InChI | InChI=1S/C13H27NOS/c1-8-12(3,4)10-16(15,14-7)11-13(5,6)9-2/h8H,1,9-11H2,2-7H3 |
| InChIKey | JBBNQLZEJLSNED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|