About 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate
2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate (PubChem CID 170264598) has the molecular formula C13H26F2O2S
and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate |
| PubChem CID | 170264598 |
| Molecular Formula | C13H26F2O2S |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)CS(C)(F)F |
| InChI | InChI=1S/C13H26F2O2S/c1-5-7-8-12(6-2)9-17-13(16)11(3)10-18(4,14)15/h11-12H,5-10H2,1-4H3 |
| InChIKey | MRMBVDQVLMEYBL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate?
The IUPAC name of 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate (CID 170264598) is 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate.
What is the SMILES notation for 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate?
The canonical SMILES for 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate is CCCCC(CC)COC(=O)C(C)CS(C)(F)F.
What is the InChIKey of 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate?
The InChIKey is MRMBVDQVLMEYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F2O2S/c1-5-7-8-12(6-2)9-17-13(16)11(3)10-18(4,14)15/h11-12H,5-10H2,1-4H3.
What are the key properties of 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate?
2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate has a molecular weight of 284.41 g/mol, XLogP of 4.59, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 3-[difluoro(methyl)-λ4-sulfanyl]-2-methylpropanoate is sourced from PubChem (CID 170264598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).