About 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate
3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate (PubChem CID 170264637) has the molecular formula C9H18F2O3S
and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate.
Molecular Properties
| Compound Name | 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate |
| PubChem CID | 170264637 |
| Molecular Formula | C9H18F2O3S |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate |
| SMILES | COC(=O)OCCCS(F)(F)C(C)(C)C |
| InChI | InChI=1S/C9H18F2O3S/c1-9(2,3)15(10,11)7-5-6-14-8(12)13-4/h5-7H2,1-4H3 |
| InChIKey | LSVCIKSVQNEVMB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate?
The IUPAC name of 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate (CID 170264637) is 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate.
What is the SMILES notation for 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate?
The canonical SMILES for 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate is COC(=O)OCCCS(F)(F)C(C)(C)C.
What is the InChIKey of 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate?
The InChIKey is LSVCIKSVQNEVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2O3S/c1-9(2,3)15(10,11)7-5-6-14-8(12)13-4/h5-7H2,1-4H3.
What are the key properties of 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate?
3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate has a molecular weight of 244.30 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(difluoro)-λ4-sulfanyl]propyl methyl carbonate is sourced from PubChem (CID 170264637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).