C15H16F3NO6 — CID 170264724
2,2,2-trifluoroethyl 2-[2-(aziridin-1-yl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 170264724) has the molecular formula C15H16F3NO6 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2-(aziridin-1-yl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2-(aziridin-1-yl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 170264724 |
| Molecular Formula | C15H16F3NO6 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2-(aziridin-1-yl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(CN1CC1)OC1C2CC3C1OC(=O)C3C2C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C15H16F3NO6/c16-15(17,18)5-23-13(21)9-6-3-7-10(9)14(22)25-12(7)11(6)24-8(20)4-19-1-2-19/h6-7,9-12H,1-5H2 |
| InChIKey | KYBJAWSVGKVCAQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|