About (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate
(1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate (PubChem CID 170264819) has the molecular formula C21H32N2O3S
and a molecular weight of 392.57 g/mol. Its IUPAC name is (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate.
Molecular Properties
| Compound Name | (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate |
| PubChem CID | 170264819 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate |
| SMILES | O=C(CN1CCSCC1)OC1CC2CC1CC21CCN(C2CCCC2)C1=O |
| InChI | InChI=1S/C21H32N2O3S/c24-19(14-22-7-9-27-10-8-22)26-18-12-16-11-15(18)13-21(16)5-6-23(20(21)25)17-3-1-2-4-17/h15-18H,1-14H2 |
| InChIKey | MEUWOYFVRVRJFF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate?
The IUPAC name of (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate (CID 170264819) is (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate.
What is the SMILES notation for (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate?
The canonical SMILES for (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate is O=C(CN1CCSCC1)OC1CC2CC1CC21CCN(C2CCCC2)C1=O.
What is the InChIKey of (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate?
The InChIKey is MEUWOYFVRVRJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O3S/c24-19(14-22-7-9-27-10-8-22)26-18-12-16-11-15(18)13-21(16)5-6-23(20(21)25)17-3-1-2-4-17/h15-18H,1-14H2.
What are the key properties of (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate?
(1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate has a molecular weight of 392.57 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1'-cyclopentyl-2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl) 2-thiomorpholin-4-ylacetate is sourced from PubChem (CID 170264819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).