About (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate
(4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate (PubChem CID 170264854) has the molecular formula C13H20N2O5S
and a molecular weight of 316.38 g/mol. Its IUPAC name is (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate |
| PubChem CID | 170264854 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate |
| SMILES | O=C(CN1CCOCC1)OC1C2CC3C1NS(=O)(=O)C3C2 |
| InChI | InChI=1S/C13H20N2O5S/c16-11(7-15-1-3-19-4-2-15)20-13-8-5-9-10(6-8)21(17,18)14-12(9)13/h8-10,12-14H,1-7H2 |
| InChIKey | QHEFNSHKQZDEQO-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate?
The IUPAC name of (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate (CID 170264854) is (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate.
What is the SMILES notation for (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate?
The canonical SMILES for (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate is O=C(CN1CCOCC1)OC1C2CC3C1NS(=O)(=O)C3C2.
What is the InChIKey of (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate?
The InChIKey is QHEFNSHKQZDEQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O5S/c16-11(7-15-1-3-19-4-2-15)20-13-8-5-9-10(6-8)21(17,18)14-12(9)13/h8-10,12-14H,1-7H2.
What are the key properties of (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate?
(4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate has a molecular weight of 316.38 g/mol, XLogP of -1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonan-9-yl) 2-morpholin-4-ylacetate is sourced from PubChem (CID 170264854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).