C21H43NO — CID 170265770
(E)-13-ethoxy-N,9,9,11,11-pentamethyltetradec-6-en-1-amine (PubChem CID 170265770) has the molecular formula C21H43NO and a molecular weight of 325.58 g/mol. Its IUPAC name is (E)-13-ethoxy-N,9,9,11,11-pentamethyltetradec-6-en-1-amine.
| Compound Name | (E)-13-ethoxy-N,9,9,11,11-pentamethyltetradec-6-en-1-amine |
|---|---|
| PubChem CID | 170265770 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | (E)-13-ethoxy-N,9,9,11,11-pentamethyltetradec-6-en-1-amine |
| SMILES | CCOC(C)CC(C)(C)CC(C)(C)C/C=C/CCCCCNC |
| InChI | InChI=1S/C21H43NO/c1-8-23-19(2)17-21(5,6)18-20(3,4)15-13-11-9-10-12-14-16-22-7/h11,13,19,22H,8-10,12,14-18H2,1-7H3/b13-11+ |
| InChIKey | XDMZWRKQWLSUKJ-ACCUITESSA-N |
| XLogP | 5.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|