About (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane
(4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 170265964) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 170265964 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)N1C[C@@H]2CC1CN2 |
| InChI | InChI=1S/C9H18N2/c1-9(2,3)11-6-7-4-8(11)5-10-7/h7-8,10H,4-6H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | FDVWVWGMABVHAS-JAMMHHFISA-N |
| XLogP | 0.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane (CID 170265964) is (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane is CC(C)(C)N1C[C@@H]2CC1CN2.
What is the InChIKey of (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is FDVWVWGMABVHAS-JAMMHHFISA-N. The full InChI is InChI=1S/C9H18N2/c1-9(2,3)11-6-7-4-8(11)5-10-7/h7-8,10H,4-6H2,1-3H3/t7-,8?/m0/s1.
What are the key properties of (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane?
(4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 154.26 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-tert-butyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 170265964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).