About 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene
2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene (PubChem CID 170266078) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene |
| PubChem CID | 170266078 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cc(F)c(CC)c(F)c1 |
| InChI | InChI=1S/C11H12F2/c1-4-9-10(12)5-8(7(2)3)6-11(9)13/h5-6H,2,4H2,1,3H3 |
| InChIKey | WVTIZCAVICCIPQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene?
The IUPAC name of 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene (CID 170266078) is 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene.
What is the SMILES notation for 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene?
The canonical SMILES for 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene is C=C(C)c1cc(F)c(CC)c(F)c1.
What is the InChIKey of 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene?
The InChIKey is WVTIZCAVICCIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2/c1-4-9-10(12)5-8(7(2)3)6-11(9)13/h5-6H,2,4H2,1,3H3.
What are the key properties of 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene?
2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene has a molecular weight of 182.21 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-difluoro-5-prop-1-en-2-ylbenzene is sourced from PubChem (CID 170266078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).