C17H22F4N2O2 — CID 170267215
2,2,2-trifluoro-N-[3-fluoro-4-methyl-5-[2-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]ethyl]phenyl]acetamide (PubChem CID 170267215) has the molecular formula C17H22F4N2O2 and a molecular weight of 362.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-fluoro-4-methyl-5-[2-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]ethyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-fluoro-4-methyl-5-[2-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 170267215 |
| Molecular Formula | C17H22F4N2O2 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-fluoro-4-methyl-5-[2-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]ethyl]phenyl]acetamide |
| SMILES | Cc1c(F)cc(NC(=O)C(F)(F)F)cc1CC[C@H]1COC(C)(C)N1C |
| InChI | InChI=1S/C17H22F4N2O2/c1-10-11(5-6-13-9-25-16(2,3)23(13)4)7-12(8-14(10)18)22-15(24)17(19,20)21/h7-8,13H,5-6,9H2,1-4H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | ORWWJAXJTJJFMX-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |