C13H15NO — CID 170267517
2,4-bis[(3E)-penta-1,3-dien-3-yl]-1,3-oxazole (PubChem CID 170267517) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,4-bis[(3E)-penta-1,3-dien-3-yl]-1,3-oxazole.
| Compound Name | 2,4-bis[(3E)-penta-1,3-dien-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 170267517 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,4-bis[(3E)-penta-1,3-dien-3-yl]-1,3-oxazole |
| SMILES | C=C/C(=C\C)c1coc(/C(C=C)=C/C)n1 |
| InChI | InChI=1S/C13H15NO/c1-5-10(6-2)12-9-15-13(14-12)11(7-3)8-4/h5-9H,1,3H2,2,4H3/b10-6+,11-8+ |
| InChIKey | CAGYMVGHQMTZLN-NSJFVGFPSA-N |
| XLogP | 3.85 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|