C32H35F4N5O — CID 170267645
(E)-4-[3-[5-[(1E,2E,4Z)-1-[(4E)-4-ethylidene-3-fluoro-1H-pyrazol-5-ylidene]-7,7,7-trifluoro-5-phenylhepta-2,4-dien-4-yl]-2-pyridinyl]propylamino]-N,N-dimethylbut-2-enamide (PubChem CID 170267645) has the molecular formula C32H35F4N5O and a molecular weight of 581.66 g/mol. Its IUPAC name is (E)-4-[3-[5-[(1E,2E,4Z)-1-[(4E)-4-ethylidene-3-fluoro-1H-pyrazol-5-ylidene]-7,7,7-trifluoro-5-phenylhepta-2,4-dien-4-yl]-2-pyridinyl]propylamino]-N,N-dimethylbut-2-enamide.
| Compound Name | (E)-4-[3-[5-[(1E,2E,4Z)-1-[(4E)-4-ethylidene-3-fluoro-1H-pyrazol-5-ylidene]-7,7,7-trifluoro-5-phenylhepta-2,4-dien-4-yl]-2-pyridinyl]propylamino]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 170267645 |
| Molecular Formula | C32H35F4N5O |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | (E)-4-[3-[5-[(1E,2E,4Z)-1-[(4E)-4-ethylidene-3-fluoro-1H-pyrazol-5-ylidene]-7,7,7-trifluoro-5-phenylhepta-2,4-dien-4-yl]-2-pyridinyl]propylamino]-N,N-dimethylbut-2-enamide |
| SMILES | C/C=c1/c(F)n[nH]/c1=C/C=C/C(=C(\CC(F)(F)F)c1ccccc1)c1ccc(CCCNC/C=C/C(=O)N(C)C)nc1 |
| InChI | InChI=1S/C32H35F4N5O/c1-4-26-29(39-40-31(26)33)15-8-14-27(28(21-32(34,35)36)23-11-6-5-7-12-23)24-17-18-25(38-22-24)13-9-19-37-20-10-16-30(42)41(2)3/h4-8,10-12,14-18,22,37,39H,9,13,19-21H2,1-3H3/b14-8+,16-10+,26-4+,28-27-,29-15+ |
| InChIKey | VRLFOURJBHBIEB-CZVOCTQYSA-N |
| XLogP | 4.81 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|