C45H27N5O3 — CID 170267879
5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-nitrophenyl)phenyl]-[1]benzofuro[3,2-c]carbazole (PubChem CID 170267879) has the molecular formula C45H27N5O3 and a molecular weight of 685.74 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-nitrophenyl)phenyl]-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-nitrophenyl)phenyl]-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 170267879 |
| Molecular Formula | C45H27N5O3 |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 685.21 |
| IUPAC Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-nitrophenyl)phenyl]-[1]benzofuro[3,2-c]carbazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-n2c3ccccc3c3c4oc5ccccc5c4ccc32)cc1 |
| InChI | InChI=1S/C45H27N5O3/c51-50(52)32-22-19-28(20-23-32)36-27-31(45-47-43(29-11-3-1-4-12-29)46-44(48-45)30-13-5-2-6-14-30)21-25-38(36)49-37-17-9-7-16-35(37)41-39(49)26-24-34-33-15-8-10-18-40(33)53-42(34)41/h1-27H |
| InChIKey | ALXCGOGRJXCDLW-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|