C45H27N5O2S — CID 170267892
11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(3-nitrophenyl)phenyl]-[1]benzothiolo[3,2-b]carbazole (PubChem CID 170267892) has the molecular formula C45H27N5O2S and a molecular weight of 701.81 g/mol. Its IUPAC name is 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(3-nitrophenyl)phenyl]-[1]benzothiolo[3,2-b]carbazole.
| Compound Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(3-nitrophenyl)phenyl]-[1]benzothiolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 170267892 |
| Molecular Formula | C45H27N5O2S |
| Molecular Weight | 701.81 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(3-nitrophenyl)phenyl]-[1]benzothiolo[3,2-b]carbazole |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-n2c3ccccc3c3cc4sc5ccccc5c4cc32)c1 |
| InChI | InChI=1S/C45H27N5O2S/c51-50(52)32-17-11-16-30(24-32)35-25-31(45-47-43(28-12-3-1-4-13-28)46-44(48-45)29-14-5-2-6-15-29)22-23-39(35)49-38-20-9-7-18-33(38)36-27-42-37(26-40(36)49)34-19-8-10-21-41(34)53-42/h1-27H |
| InChIKey | HVNNMKHHJCTEHF-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.81 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|