C22H36N2 — CID 170268803
(3Z)-5-[1-(but-3-enylamino)ethenyl]-3-(2,2-dimethylpropylidene)-N,2,4,4,6-pentamethylcyclohexa-1,5-dien-1-amine (PubChem CID 170268803) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is (3Z)-5-[1-(but-3-enylamino)ethenyl]-3-(2,2-dimethylpropylidene)-N,2,4,4,6-pentamethylcyclohexa-1,5-dien-1-amine.
| Compound Name | (3Z)-5-[1-(but-3-enylamino)ethenyl]-3-(2,2-dimethylpropylidene)-N,2,4,4,6-pentamethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 170268803 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | (3Z)-5-[1-(but-3-enylamino)ethenyl]-3-(2,2-dimethylpropylidene)-N,2,4,4,6-pentamethylcyclohexa-1,5-dien-1-amine |
| SMILES | C=CCCNC(=C)C1=C(C)C(NC)=C(C)/C(=C\C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C22H36N2/c1-11-12-13-24-17(4)19-16(3)20(23-10)15(2)18(22(19,8)9)14-21(5,6)7/h11,14,23-24H,1,4,12-13H2,2-3,5-10H3/b18-14+ |
| InChIKey | FKQBMLKGQSPBFU-NBVRZTHBSA-N |
| XLogP | 5.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|