C15H22N2 — CID 170268876
(3Z)-3-ethylidene-5-(3-iminoprop-1-en-2-yl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine (PubChem CID 170268876) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (3Z)-3-ethylidene-5-(3-iminoprop-1-en-2-yl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine.
| Compound Name | (3Z)-3-ethylidene-5-(3-iminoprop-1-en-2-yl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 170268876 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (3Z)-3-ethylidene-5-(3-iminoprop-1-en-2-yl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C/C(=C)C1=C(C)C(N)=C(C)/C(=C\C)C1(C)C |
| InChI | InChI=1S/C15H22N2/c1-7-12-10(3)14(17)11(4)13(9(2)8-16)15(12,5)6/h7-8,16H,2,17H2,1,3-6H3/b12-7+,16-8+ |
| InChIKey | IKHDQMAOSSNJFZ-LFBPKNJISA-N |
| XLogP | 3.73 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|