C13H24O6 — CID 170270349
1-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-3,3-dimethylbutan-2-one (PubChem CID 170270349) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 170270349 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-3,3-dimethylbutan-2-one |
| SMILES | C[C@H]1[C@H](OCC(=O)C(C)(C)C)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H24O6/c1-7-10(16)11(17)8(5-14)19-12(7)18-6-9(15)13(2,3)4/h7-8,10-12,14,16-17H,5-6H2,1-4H3/t7-,8-,10-,11+,12-/m1/s1 |
| InChIKey | RVXOCPQLTVKPIP-OWRUSBMPSA-N |
| XLogP | -0.31 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |