C35H53NO3S — CID 170270588
(3R)-3-[(5S,8R,9S,10S,13R,14S)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(1-thiophen-2-yloctyl)butanamide (PubChem CID 170270588) has the molecular formula C35H53NO3S and a molecular weight of 567.88 g/mol. Its IUPAC name is (3R)-3-[(5S,8R,9S,10S,13R,14S)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(1-thiophen-2-yloctyl)butanamide.
| Compound Name | (3R)-3-[(5S,8R,9S,10S,13R,14S)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(1-thiophen-2-yloctyl)butanamide |
|---|---|
| PubChem CID | 170270588 |
| Molecular Formula | C35H53NO3S |
| Molecular Weight | 567.88 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | (3R)-3-[(5S,8R,9S,10S,13R,14S)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(1-thiophen-2-yloctyl)butanamide |
| SMILES | CCCCCCCC(NC(=O)C[C@@H](C)C1CC[C@H]2[C@@H]3C(=O)C[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)c1cccs1 |
| InChI | InChI=1S/C35H53NO3S/c1-5-6-7-8-9-11-29(31-12-10-19-40-31)36-32(39)20-23(2)26-13-14-27-33-28(16-18-35(26,27)4)34(3)17-15-25(37)21-24(34)22-30(33)38/h10,12,19,23-24,26-29,33H,5-9,11,13-18,20-22H2,1-4H3,(H,36,39)/t23-,24+,26?,27+,28+,29?,33+,34+,35-/m1/s1 |
| InChIKey | UZEDGFQMELAEKF-FOBKLESRSA-N |
| XLogP | 8.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.88 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|