C18H12F6N6O — CID 170270760
(E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-methyl-3-pyridinyl)prop-2-enamide (PubChem CID 170270760) has the molecular formula C18H12F6N6O and a molecular weight of 442.32 g/mol. Its IUPAC name is (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-methyl-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-methyl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 170270760 |
| Molecular Formula | C18H12F6N6O |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-methyl-3-pyridinyl)prop-2-enamide |
| SMILES | Cc1ccc(/C(=C\n2cnc(-c3cc(C(F)(F)F)nc(C(F)(F)F)c3)n2)C(N)=O)cn1 |
| InChI | InChI=1S/C18H12F6N6O/c1-9-2-3-10(6-26-9)12(15(25)31)7-30-8-27-16(29-30)11-4-13(17(19,20)21)28-14(5-11)18(22,23)24/h2-8H,1H3,(H2,25,31)/b12-7+ |
| InChIKey | INZFQSVYVJLBJR-KPKJPENVSA-N |
| XLogP | 3.56 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|