C23H17F3N6O — CID 170270891
(E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-isoquinolin-8-ylprop-2-enamide (PubChem CID 170270891) has the molecular formula C23H17F3N6O and a molecular weight of 450.42 g/mol. Its IUPAC name is (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-isoquinolin-8-ylprop-2-enamide.
| Compound Name | (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-isoquinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 170270891 |
| Molecular Formula | C23H17F3N6O |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-isoquinolin-8-ylprop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C3CC3)nc(C(F)(F)F)c2)n1)c1cccc2ccncc12 |
| InChI | InChI=1S/C23H17F3N6O/c24-23(25,26)20-9-15(8-19(30-20)14-4-5-14)22-29-12-32(31-22)11-18(21(27)33)16-3-1-2-13-6-7-28-10-17(13)16/h1-3,6-12,14H,4-5H2,(H2,27,33)/b18-11+ |
| InChIKey | LYLKKTHFGJMRTQ-WOJGMQOQSA-N |
| XLogP | 4.27 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|