About (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine
(1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine (PubChem CID 170271202) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine |
| PubChem CID | 170271202 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine |
| SMILES | C=C/C=C(/F)N(C)C(C)CC |
| InChI | InChI=1S/C9H16FN/c1-5-7-9(10)11(4)8(3)6-2/h5,7-8H,1,6H2,2-4H3/b9-7- |
| InChIKey | AXDHRUJIALGDIJ-CLFYSBASSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine?
The IUPAC name of (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine (CID 170271202) is (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine?
The canonical SMILES for (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine is C=C/C=C(/F)N(C)C(C)CC.
What is the InChIKey of (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine?
The InChIKey is AXDHRUJIALGDIJ-CLFYSBASSA-N. The full InChI is InChI=1S/C9H16FN/c1-5-7-9(10)11(4)8(3)6-2/h5,7-8H,1,6H2,2-4H3/b9-7-.
What are the key properties of (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine?
(1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine has a molecular weight of 157.23 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N-butan-2-yl-1-fluoro-N-methylbuta-1,3-dien-1-amine is sourced from PubChem (CID 170271202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).