C17H27N3O3 — CID 170271284
tert-butyl 4-[(2Z,4Z)-5-amino-3-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 170271284) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 4-[(2Z,4Z)-5-amino-3-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2Z,4Z)-5-amino-3-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 170271284 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl 4-[(2Z,4Z)-5-amino-3-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=N/C(N)=C\C(OC)=C(/C)C1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-12(14(22-6)11-15(18)19-5)13-7-9-20(10-8-13)16(21)23-17(2,3)4/h7,11H,5,8-10,18H2,1-4,6H3/b14-12-,15-11- |
| InChIKey | JYGOKLOIHXYXRS-LFAXOCKOSA-N |
| XLogP | 2.97 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|