C15H21NO7 — CID 170271296
2-[methyl-[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-3-phenylpropanoic acid (PubChem CID 170271296) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is 2-[methyl-[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[methyl-[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 170271296 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[methyl-[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-3-phenylpropanoic acid |
| SMILES | CN(C(Cc1ccccc1)C(=O)O)C1(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C15H21NO7/c1-16(15(22)13(19)12(18)11(8-17)23-15)10(14(20)21)7-9-5-3-2-4-6-9/h2-6,10-13,17-19,22H,7-8H2,1H3,(H,20,21) |
| InChIKey | UWLSPFLHSUDXHP-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|