C16H22N2 — CID 170271348
1-[(2E,4E,8Z)-deca-2,4,8-trienyl]-4-methylpyridin-2-imine (PubChem CID 170271348) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-[(2E,4E,8Z)-deca-2,4,8-trienyl]-4-methylpyridin-2-imine.
| Compound Name | 1-[(2E,4E,8Z)-deca-2,4,8-trienyl]-4-methylpyridin-2-imine |
|---|---|
| PubChem CID | 170271348 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-[(2E,4E,8Z)-deca-2,4,8-trienyl]-4-methylpyridin-2-imine |
| SMILES | [H]/N=c1\cc(C)ccn1C/C=C/C=C/CC/C=C\C |
| InChI | InChI=1S/C16H22N2/c1-3-4-5-6-7-8-9-10-12-18-13-11-15(2)14-16(18)17/h3-4,7-11,13-14,17H,5-6,12H2,1-2H3/b4-3-,8-7+,10-9+,17-16+ |
| InChIKey | HREFCPRLVXSDFK-VNCGVKOFSA-N |
| XLogP | 3.74 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|