C29H38ClN3O2 — CID 170271565
5-(diethylamino)pentyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (PubChem CID 170271565) has the molecular formula C29H38ClN3O2 and a molecular weight of 496.10 g/mol. Its IUPAC name is 5-(diethylamino)pentyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate.
| Compound Name | 5-(diethylamino)pentyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170271565 |
| Molecular Formula | C29H38ClN3O2 |
| Molecular Weight | 496.10 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 5-(diethylamino)pentyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| SMILES | CCN(CC)CCCCCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C29H38ClN3O2/c1-3-32(4-2)17-6-5-7-20-35-29(34)33-18-14-22(15-19-33)27-26-13-12-25(30)21-24(26)11-10-23-9-8-16-31-28(23)27/h8-9,12-13,16,21H,3-7,10-11,14-15,17-20H2,1-2H3 |
| InChIKey | LXEDWHJLFLGCAU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.10 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|