C20H17F2N3O4 — CID 170271654
(E)-1-[4-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 170271654) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is (E)-1-[4-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 170271654 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (E)-1-[4-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccncc1)N1CCN(C(=O)c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C20H17F2N3O4/c21-20(22)28-16-3-2-15(13-17(16)29-20)19(27)25-11-9-24(10-12-25)18(26)4-1-14-5-7-23-8-6-14/h1-8,13H,9-12H2/b4-1+ |
| InChIKey | ZYNWINZABIJIBL-DAFODLJHSA-N |
| XLogP | 2.40 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|