C10H10F2N2 — CID 170272006
5-(1,2-dihydropyridin-2-yl)-2,6-difluoro-1,2-dihydropyridine (PubChem CID 170272006) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 5-(1,2-dihydropyridin-2-yl)-2,6-difluoro-1,2-dihydropyridine.
| Compound Name | 5-(1,2-dihydropyridin-2-yl)-2,6-difluoro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 170272006 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-(1,2-dihydropyridin-2-yl)-2,6-difluoro-1,2-dihydropyridine |
| SMILES | FC1=C(C2C=CC=CN2)C=CC(F)N1 |
| InChI | InChI=1S/C10H10F2N2/c11-9-5-4-7(10(12)14-9)8-3-1-2-6-13-8/h1-6,8-9,13-14H |
| InChIKey | KNWQBZRMZRWUQN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|