About (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol
(1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol (PubChem CID 170272183) has the molecular formula C13H22N4O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol |
| PubChem CID | 170272183 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol |
| SMILES | COc1cc(N)ncc1N1CCN[C@@H]([C@H](C)O)CC1 |
| InChI | InChI=1S/C13H22N4O2/c1-9(18)10-3-5-17(6-4-15-10)11-8-16-13(14)7-12(11)19-2/h7-10,15,18H,3-6H2,1-2H3,(H2,14,16)/t9-,10+/m0/s1 |
| InChIKey | PFVOVITZUMDYQS-VHSXEESVSA-N |
| XLogP | 0.22 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol?
The IUPAC name of (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol (CID 170272183) is (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol.
What is the SMILES notation for (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol?
The canonical SMILES for (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol is COc1cc(N)ncc1N1CCN[C@@H]([C@H](C)O)CC1.
What is the InChIKey of (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol?
The InChIKey is PFVOVITZUMDYQS-VHSXEESVSA-N. The full InChI is InChI=1S/C13H22N4O2/c1-9(18)10-3-5-17(6-4-15-10)11-8-16-13(14)7-12(11)19-2/h7-10,15,18H,3-6H2,1-2H3,(H2,14,16)/t9-,10+/m0/s1.
What are the key properties of (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol?
(1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol has a molecular weight of 266.34 g/mol, XLogP of 0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(5R)-1-(6-amino-4-methoxy-3-pyridinyl)-1,4-diazepan-5-yl]ethanol is sourced from PubChem (CID 170272183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).