About 4-amino-6,6-dimethyl-5-methylideneheptan-2-one
4-amino-6,6-dimethyl-5-methylideneheptan-2-one (PubChem CID 170272332) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-amino-6,6-dimethyl-5-methylideneheptan-2-one.
Molecular Properties
| Compound Name | 4-amino-6,6-dimethyl-5-methylideneheptan-2-one |
| PubChem CID | 170272332 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-amino-6,6-dimethyl-5-methylideneheptan-2-one |
| SMILES | C=C(C(N)CC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO/c1-7(12)6-9(11)8(2)10(3,4)5/h9H,2,6,11H2,1,3-5H3 |
| InChIKey | NYPIUMRUEQMVNB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6,6-dimethyl-5-methylideneheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6,6-dimethyl-5-methylideneheptan-2-one?
The IUPAC name of 4-amino-6,6-dimethyl-5-methylideneheptan-2-one (CID 170272332) is 4-amino-6,6-dimethyl-5-methylideneheptan-2-one.
What is the SMILES notation for 4-amino-6,6-dimethyl-5-methylideneheptan-2-one?
The canonical SMILES for 4-amino-6,6-dimethyl-5-methylideneheptan-2-one is C=C(C(N)CC(C)=O)C(C)(C)C.
What is the InChIKey of 4-amino-6,6-dimethyl-5-methylideneheptan-2-one?
The InChIKey is NYPIUMRUEQMVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-7(12)6-9(11)8(2)10(3,4)5/h9H,2,6,11H2,1,3-5H3.
What are the key properties of 4-amino-6,6-dimethyl-5-methylideneheptan-2-one?
4-amino-6,6-dimethyl-5-methylideneheptan-2-one has a molecular weight of 169.27 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6,6-dimethyl-5-methylideneheptan-2-one is sourced from PubChem (CID 170272332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).