C11H9F4N5O2 — CID 17027273
N-(2-ethyltetrazol-5-yl)-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17027273) has the molecular formula C11H9F4N5O2 and a molecular weight of 319.22 g/mol. Its IUPAC name is N-(2-ethyltetrazol-5-yl)-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-(2-ethyltetrazol-5-yl)-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17027273 |
| Molecular Formula | C11H9F4N5O2 |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-(2-ethyltetrazol-5-yl)-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | CCn1nnc(NC(=O)c2c(F)c(F)c(OC)c(F)c2F)n1 |
| InChI | InChI=1S/C11H9F4N5O2/c1-3-20-18-11(17-19-20)16-10(21)4-5(12)7(14)9(22-2)8(15)6(4)13/h3H2,1-2H3,(H,16,18,21) |
| InChIKey | WUNYZSQRWAOHGN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|