C30H29F2N5O3 — CID 170272797
2-[6-[6-[[2-(2,6-difluorophenyl)ethylamino]methyl]imidazo[1,2-a]pyridin-8-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 170272797) has the molecular formula C30H29F2N5O3 and a molecular weight of 545.59 g/mol. Its IUPAC name is 2-[6-[6-[[2-(2,6-difluorophenyl)ethylamino]methyl]imidazo[1,2-a]pyridin-8-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[6-[6-[[2-(2,6-difluorophenyl)ethylamino]methyl]imidazo[1,2-a]pyridin-8-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 170272797 |
| Molecular Formula | C30H29F2N5O3 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 2-[6-[6-[[2-(2,6-difluorophenyl)ethylamino]methyl]imidazo[1,2-a]pyridin-8-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2cc(-c3cc(CNCCc4c(F)cccc4F)cn4ccnc34)ccc2C1=O |
| InChI | InChI=1S/C30H29F2N5O3/c1-33-29(39)27(6-3-13-38)37-18-21-15-20(7-8-22(21)30(37)40)24-14-19(17-36-12-11-35-28(24)36)16-34-10-9-23-25(31)4-2-5-26(23)32/h2,4-5,7-8,11-15,17,27,34H,3,6,9-10,16,18H2,1H3,(H,33,39) |
| InChIKey | DALSNOTTWFVFCK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|