C8H12F6OS — CID 170273219
1,1,1,2,3,4-hexafluoro-2,3-dimethyl-4-methylsulfinylpentane (PubChem CID 170273219) has the molecular formula C8H12F6OS and a molecular weight of 270.24 g/mol. Its IUPAC name is 1,1,1,2,3,4-hexafluoro-2,3-dimethyl-4-methylsulfinylpentane.
| Compound Name | 1,1,1,2,3,4-hexafluoro-2,3-dimethyl-4-methylsulfinylpentane |
|---|---|
| PubChem CID | 170273219 |
| Molecular Formula | C8H12F6OS |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,1,2,3,4-hexafluoro-2,3-dimethyl-4-methylsulfinylpentane |
| SMILES | CS(=O)C(C)(F)C(C)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6OS/c1-5(9,7(3,11)16(4)15)6(2,10)8(12,13)14/h1-4H3 |
| InChIKey | IWJIEASRGDXESK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |