About 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one
4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one (PubChem CID 170273638) has the molecular formula C20H31N5O
and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one.
Molecular Properties
| Compound Name | 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one |
| PubChem CID | 170273638 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one |
| SMILES | CCC(=O)C(C)(CC)CC(C)(CC)n1cc(-c2cnc(CC)nc2)nn1 |
| InChI | InChI=1S/C20H31N5O/c1-7-17(26)19(5,9-3)14-20(6,10-4)25-13-16(23-24-25)15-11-21-18(8-2)22-12-15/h11-13H,7-10,14H2,1-6H3 |
| InChIKey | DHLXWGSTKJYBJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one?
The IUPAC name of 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one (CID 170273638) is 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one.
What is the SMILES notation for 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one?
The canonical SMILES for 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one is CCC(=O)C(C)(CC)CC(C)(CC)n1cc(-c2cnc(CC)nc2)nn1.
What is the InChIKey of 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one?
The InChIKey is DHLXWGSTKJYBJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N5O/c1-7-17(26)19(5,9-3)14-20(6,10-4)25-13-16(23-24-25)15-11-21-18(8-2)22-12-15/h11-13H,7-10,14H2,1-6H3.
What are the key properties of 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one?
4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one has a molecular weight of 357.50 g/mol, XLogP of 4.21, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-[4-(2-ethylpyrimidin-5-yl)triazol-1-yl]-4,6-dimethyloctan-3-one is sourced from PubChem (CID 170273638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).