About 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane
4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane (PubChem CID 170274165) has the molecular formula C14H22F2O
and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane.
Molecular Properties
| Compound Name | 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane |
| PubChem CID | 170274165 |
| Molecular Formula | C14H22F2O |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane |
| SMILES | C=C(CCC)C(=C)COC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H22F2O/c1-4-5-11(2)12(3)10-17-13-6-8-14(15,16)9-7-13/h13H,2-10H2,1H3 |
| InChIKey | WRHOYFQICZPGNT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane?
The IUPAC name of 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane (CID 170274165) is 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane.
What is the SMILES notation for 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane?
The canonical SMILES for 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane is C=C(CCC)C(=C)COC1CCC(F)(F)CC1.
What is the InChIKey of 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane?
The InChIKey is WRHOYFQICZPGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2O/c1-4-5-11(2)12(3)10-17-13-6-8-14(15,16)9-7-13/h13H,2-10H2,1H3.
What are the key properties of 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane?
4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane has a molecular weight of 244.32 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylidenehexoxy)-1,1-difluorocyclohexane is sourced from PubChem (CID 170274165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).