About 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate
2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate (PubChem CID 170274497) has the molecular formula C18H24F3N3O
and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate |
| PubChem CID | 170274497 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate |
| SMILES | C/C=C\N=C(OCCNC)\C(=C\CC)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3N3O/c1-4-6-16(17(23-11-5-2)25-13-12-22-3)24-15-9-7-14(8-10-15)18(19,20)21/h5-11,22,24H,4,12-13H2,1-3H3/b11-5-,16-6-,23-17- |
| InChIKey | LMHQCWAWDUPMCW-HSCRRKNTSA-N |
| XLogP | 4.58 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
The IUPAC name of 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate (CID 170274497) is 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate.
What is the SMILES notation for 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
The canonical SMILES for 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate is C/C=C\N=C(OCCNC)\C(=C\CC)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
The InChIKey is LMHQCWAWDUPMCW-HSCRRKNTSA-N. The full InChI is InChI=1S/C18H24F3N3O/c1-4-6-16(17(23-11-5-2)25-13-12-22-3)24-15-9-7-14(8-10-15)18(19,20)21/h5-11,22,24H,4,12-13H2,1-3H3/b11-5-,16-6-,23-17-.
What are the key properties of 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate?
2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate has a molecular weight of 355.40 g/mol, XLogP of 4.58, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl (Z)-N-[(Z)-prop-1-enyl]-2-[4-(trifluoromethyl)anilino]pent-2-enimidate is sourced from PubChem (CID 170274497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).