C13H19FO7 — CID 170274650
[(2S,3S,4S,5S)-5,6-diacetyloxy-4-fluoro-3-methyloxan-2-yl]methyl acetate (PubChem CID 170274650) has the molecular formula C13H19FO7 and a molecular weight of 306.29 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-5,6-diacetyloxy-4-fluoro-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S)-5,6-diacetyloxy-4-fluoro-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170274650 |
| Molecular Formula | C13H19FO7 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(2S,3S,4S,5S)-5,6-diacetyloxy-4-fluoro-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H](F)[C@H]1C |
| InChI | InChI=1S/C13H19FO7/c1-6-10(5-18-7(2)15)21-13(20-9(4)17)12(11(6)14)19-8(3)16/h6,10-13H,5H2,1-4H3/t6-,10+,11-,12+,13?/m0/s1 |
| InChIKey | PUSBJKWPNLTQSE-GGTJPUKVSA-N |
| XLogP | 0.74 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|