About N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine
N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine (PubChem CID 170275189) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine.
Molecular Properties
| Compound Name | N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine |
| PubChem CID | 170275189 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine |
| SMILES | C/C=C\C1=C(N(C)CCC)N=CCN=C1C |
| InChI | InChI=1S/C13H21N3/c1-5-7-12-11(3)14-8-9-15-13(12)16(4)10-6-2/h5,7,9H,6,8,10H2,1-4H3/b7-5- |
| InChIKey | IOBYRCHSVSHRSI-ALCCZGGFSA-N |
| XLogP | 2.66 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine?
The IUPAC name of N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine (CID 170275189) is N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine.
What is the SMILES notation for N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine?
The canonical SMILES for N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine is C/C=C\C1=C(N(C)CCC)N=CCN=C1C.
What is the InChIKey of N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine?
The InChIKey is IOBYRCHSVSHRSI-ALCCZGGFSA-N. The full InChI is InChI=1S/C13H21N3/c1-5-7-12-11(3)14-8-9-15-13(12)16(4)10-6-2/h5,7,9H,6,8,10H2,1-4H3/b7-5-.
What are the key properties of N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine?
N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine has a molecular weight of 219.33 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,7-dimethyl-6-[(Z)-prop-1-enyl]-N-propyl-2H-1,4-diazepin-5-amine is sourced from PubChem (CID 170275189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).